Introduction:Basic information about CAS 5268-74-6|3-Methylbenzo[d]thiazolo[3,2-a]imidazole-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Methylbenzo[d]thiazolo[3,2-a]imidazole-2-carboxylic acid |
|---|
| CAS Number | 5268-74-6 | Molecular Weight | 232.25800 |
|---|
| Density | 1.57g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C11H8N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-Methyl[1,3]thiazolo[3,2-a]benzimidazole-2-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.57g/cm3 |
|---|
| Molecular Formula | C11H8N2O2S |
|---|
| Molecular Weight | 232.25800 |
|---|
| Exact Mass | 232.03100 |
|---|
| PSA | 82.84000 |
|---|
| LogP | 2.55560 |
|---|
| Index of Refraction | 1.778 |
|---|
| InChIKey | LOPCKNAVKCPFNY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(C(=O)O)sc2nc3ccccc3n12 |
|---|