Introduction：Basic information about CAS 10031-71-7|papaya isobutyrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | papaya isobutyrate |
|---|
| CAS Number | 10031-71-7 | Molecular Weight | 234.33400 |
|---|
| Density | 0.969g/cm3 | Boiling Point | 314.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H22O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 109.8ºC |
|---|
Names
| Name | (2-methyl-4-phenylbutan-2-yl) 2-methylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.969g/cm3 |
|---|
| Boiling Point | 314.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H22O2 |
|---|
| Molecular Weight | 234.33400 |
|---|
| Flash Point | 109.8ºC |
|---|
| Exact Mass | 234.16200 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.59700 |
|---|
| Vapour Pressure | 0.000465mmHg at 25°C |
|---|
| Index of Refraction | 1.49 |
|---|
| InChIKey | WCEXWNUHYPYHDN-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C(=O)OC(C)(C)CCc1ccccc1 |
|---|
Synonyms
| Propanoic acid,2-methyl-,1,1-dimethyl-3-phenylpropyl ester |
| Dmpec isobutyrate |
| FEMA No. 2736 |
| EINECS 233-092-8 |
| Dimethyl phenethyl carbinyl isobutyrate |
| UNII-G0GW9X884I |
| Dmpec 2-methylpropanoate |
