Introduction：Basic information about CAS 74039-30-8|3,4,5-tribromo-1H-pyrrole-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4,5-tribromo-1H-pyrrole-2-carboxylic acid |
|---|
| CAS Number | 74039-30-8 | Molecular Weight | 347.78700 |
|---|
| Density | 2.699g/cm3 | Boiling Point | 468.3ºC at 760 mmHg |
|---|
| Molecular Formula | C5H2Br3NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 237ºC |
|---|
Names
| Name | 3,4,5-tribromo-1H-pyrrole-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.699g/cm3 |
|---|
| Boiling Point | 468.3ºC at 760 mmHg |
|---|
| Molecular Formula | C5H2Br3NO2 |
|---|
| Molecular Weight | 347.78700 |
|---|
| Flash Point | 237ºC |
|---|
| Exact Mass | 344.76400 |
|---|
| PSA | 53.09000 |
|---|
| LogP | 3.00040 |
|---|
| Index of Refraction | 1.716 |
|---|
| InChIKey | GPADKIKEHFMOHG-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1[nH]c(Br)c(Br)c1Br |
|---|
Synonyms
| Tribrompyrrolcarbonsaeure |
| 3,4,5-Tribrom-pyrrol-2-carbonsaeure |
| 3,4,5-tribromo-pyrrole-2-carboxylic acid |
| Pyrrole-2-carboxylic acid,3,4,5-tribromo |
