Introduction：Basic information about CAS 74912-42-8|(3-bromo-4-hydroxy-3-nitropentan-2-yl) decanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3-bromo-4-hydroxy-3-nitropentan-2-yl) decanoate |
|---|
| CAS Number | 74912-42-8 | Molecular Weight | 382.29100 |
|---|
| Density | 1.258g/cm3 | Boiling Point | 399.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H28BrNO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 195.3ºC |
|---|
Names
| Name | (3-bromo-4-hydroxy-3-nitropentan-2-yl) decanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.258g/cm3 |
|---|
| Boiling Point | 399.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H28BrNO5 |
|---|
| Molecular Weight | 382.29100 |
|---|
| Flash Point | 195.3ºC |
|---|
| Exact Mass | 381.11500 |
|---|
| PSA | 92.35000 |
|---|
| LogP | 4.33070 |
|---|
| Index of Refraction | 1.494 |
|---|
| InChIKey | JLPOMTDHZCNARV-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCCC(=O)OC(C)C(Br)(C(C)O)[N+](=O)[O-] |
|---|
Synonyms
| EINECS 278-020-6 |
| Decanoic acid,2-bromo-3-hydroxy-1-methyl-2-nitrobutyl ester |
| 2-Bromo-3-hydroxy-1-methyl-2-nitrobutyl decanoate |
