Introduction：Basic information about CAS 74956-19-7|3-[[4-[(2,6-dichloro-4-nitrophenyl)azo]phenyl](2-phenoxyethyl)amino]propiononitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[[4-[(2,6-dichloro-4-nitrophenyl)azo]phenyl](2-phenoxyethyl)amino]propiononitrile |
|---|
| CAS Number | 74956-19-7 | Molecular Weight | 484.33500 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 694.4ºC at 760 mmHg |
|---|
| Molecular Formula | C23H19Cl2N5O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 373.8ºC |
|---|
Names
| Name | 3-[4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-(2-phenoxyethyl)anilino]propanenitrile |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 694.4ºC at 760 mmHg |
|---|
| Molecular Formula | C23H19Cl2N5O3 |
|---|
| Molecular Weight | 484.33500 |
|---|
| Flash Point | 373.8ºC |
|---|
| Exact Mass | 483.08600 |
|---|
| PSA | 106.80000 |
|---|
| LogP | 7.63928 |
|---|
| Index of Refraction | 1.626 |
|---|
| InChIKey | YQXRNIHTMJZVMU-UHFFFAOYSA-N |
|---|
| SMILES | N#CCCN(CCOc1ccccc1)c1ccc(N=Nc2c(Cl)cc([N+](=O)[O-])cc2Cl)cc1 |
|---|
