Introduction:Basic information about CAS 50892-81-4|1-(2-Furyl)-pyrido(3,4-b)indole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(2-Furyl)-pyrido(3,4-b)indole |
|---|
| CAS Number | 50892-81-4 | Molecular Weight | 234.25300 |
|---|
| Density | 1.321g/cm3 | Boiling Point | 468.7ºC at 760mmHg |
|---|
| Molecular Formula | C15H10N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247.8ºC |
|---|
Names
| Name | 1-(furan-2-yl)-9H-pyrido[3,4-b]indole |
|---|
Chemical & Physical Properties
| Density | 1.321g/cm3 |
|---|
| Boiling Point | 468.7ºC at 760mmHg |
|---|
| Molecular Formula | C15H10N2O |
|---|
| Molecular Weight | 234.25300 |
|---|
| Flash Point | 247.8ºC |
|---|
| Exact Mass | 234.07900 |
|---|
| PSA | 41.82000 |
|---|
| LogP | 3.97610 |
|---|
| Index of Refraction | 1.738 |
|---|
| InChIKey | CNWBTQXHKWLFIJ-UHFFFAOYSA-N |
|---|
| SMILES | c1coc(-c2nccc3c2[nH]c2ccccc23)c1 |
|---|