Introduction：Basic information about CAS 60384-53-4|ent-Galanthamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ent-Galanthamine |
|---|
| CAS Number | 60384-53-4 | Molecular Weight | 272.33900 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 439.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H17FN2O2S | Melting Point | 123-126ºC |
|---|
| MSDS | / | Flash Point | 219.5ºC |
|---|
Names
| Name | 1-[(2-fluorophenyl)methyl]-4-methylsulfonylpiperazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 439.3ºC at 760 mmHg |
|---|
| Melting Point | 123-126ºC |
|---|
| Molecular Formula | C12H17FN2O2S |
|---|
| Molecular Weight | 272.33900 |
|---|
| Flash Point | 219.5ºC |
|---|
| Exact Mass | 272.09900 |
|---|
| PSA | 49.00000 |
|---|
| LogP | 1.85950 |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | ASUTZQLVASHGKV-SUYBPPKGSA-N |
|---|
| SMILES | COc1ccc2c3c1OC1CC(O)C=CC31CCN(C)C2 |
|---|
Synonyms
| (+/-)galanthamine |
| (+/-)-(4aS,6R,8aS)-4a,5,9,10,11,12-hexahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-ef][2]benzazepin-6-ol |
| 1-(2-Fluoro-benzyl)-4-methanesulfonyl-piperazine |
