Introduction:Basic information about CAS 292150-20-0|FMOC-alpha-glutamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | FMOC-alpha-glutamine |
|---|
| CAS Number | 292150-20-0 | Molecular Weight | 368.383 |
|---|
| Density | 1.332±0.06 g/cm3 | Boiling Point | 687.7±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H20N2O5 | Melting Point | 204.3-205.4 ºC (methanol ) |
|---|
| MSDS | / | Flash Point | 369.7±31.5 °C |
|---|
Names
| Name | 5-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.332±0.06 g/cm3 |
|---|
| Boiling Point | 687.7±55.0 °C at 760 mmHg |
|---|
| Melting Point | 204.3-205.4 ºC (methanol ) |
|---|
| Molecular Formula | C20H20N2O5 |
|---|
| Molecular Weight | 368.383 |
|---|
| Flash Point | 369.7±31.5 °C |
|---|
| Exact Mass | 368.137207 |
|---|
| PSA | 123.20000 |
|---|
| LogP | 2.55 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | MZRFDZFXTSDMFA-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)C(CCC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
|---|
| Water Solubility | Practically insoluble (0.031 g/L) (25 ºC) |
|---|
Safety Information
Synonyms
| N2-((9H-Fluoren-9-ylmethoxy)carbonyl)-L-glutamine |
| Na-(9-Fluorenylmethoxycarbonyl)-L-glutamine |
| N-Fmoc-D-isoglutamine |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-α-glutamine |
| L-Glutamine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Fmoc-D-isoGln-OH |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-glutamine |
| I14-7729 |
| FMOC-alpha-glutamine |
| (4R)-5-Amino-4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-5-oxopentanoic acid |