Introduction：Basic information about CAS 72928-10-0|Solvent Red 210, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Solvent Red 210 |
|---|
| CAS Number | 72928-10-0 | Molecular Weight | 443.92500 |
|---|
| Density | 1.261g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C26H22ClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (4Z)-4-[(4-chloro-2-methylphenyl)hydrazinylidene]-N-(2,4-dimethylphenyl)-3-oxonaphthalene-2-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.261g/cm3 |
|---|
| Molecular Formula | C26H22ClN3O2 |
|---|
| Molecular Weight | 443.92500 |
|---|
| Exact Mass | 443.14000 |
|---|
| PSA | 74.05000 |
|---|
| LogP | 7.86470 |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | AKIQNEPAISLMBH-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(NC(=O)c2cc3ccccc3c(N=Nc3ccc(Cl)cc3C)c2O)c(C)c1 |
|---|
