Introduction：Basic information about CAS 375-92-8|Perfluoroheptanesulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Perfluoroheptanesulfonic acid |
|---|
| CAS Number | 375-92-8 | Molecular Weight | 450.12200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C7HF15O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | perfluoroheptanesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C7HF15O3S |
|---|
| Molecular Weight | 450.12200 |
|---|
| Exact Mass | 449.94100 |
|---|
| PSA | 62.75000 |
|---|
| LogP | 5.28660 |
|---|
| InChIKey | OYGQVDSRYXATEL-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | C |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| pentadecafluoroheptanesulfonic acid |
| Pentadecafluor-heptan-1-sulfonsaeure |
| 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-PENTADECAFLUOROHEPTANE-1-SULPHONIC ACID |
| pentadecafluoro-heptane-1-sulfonic acid |
| Perfluorheptan-sulfonsaeure |
| Pentadecafluor-heptansulfonsaeure |
| 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonic acid |
| 1-Heptanesulfonic acid,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoro- |
| Perfluoroheptanesulfonic acid |
