Introduction：Basic information about CAS 32857-62-8|4-(Trifluoromethyl)phenylacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(Trifluoromethyl)phenylacetic acid |
|---|
| CAS Number | 32857-62-8 | Molecular Weight | 204.146 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 263.1±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7F3O2 | Melting Point | 82-85 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 112.9±25.9 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-[4-(trifluoromethyl)phenyl]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 263.1±35.0 °C at 760 mmHg |
|---|
| Melting Point | 82-85 °C(lit.) |
|---|
| Molecular Formula | C9H7F3O2 |
|---|
| Molecular Weight | 204.146 |
|---|
| Flash Point | 112.9±25.9 °C |
|---|
| Exact Mass | 204.039810 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 2.08 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.475 |
|---|
| InChIKey | HNORVZDAANCHAY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1ccc(C(F)(F)F)cc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Articles1
More Articles
| Constructing multiply substituted arenes using sequential palladium(II)-catalyzed C-H olefination. Angew. Chem. Int. Ed. Engl. 49(35) , 6169-73, (2010)
| |
Synonyms
| 2-[4-(Trifluoromethyl)phenyl]acetic acid |
| Benzeneacetic acid, 4-(trifluoromethyl)- |
| (alpha,alpha,alpha-Trifluoro-p-tolyl)acetic acid |
| (α,α,α-Trifluoro-p-tolyl)acetic acid |
| EINECS 251-263-5 |
| [4-(Trifluoromethyl)phenyl]acetic acid |
| 2-(4-(Trifluoromethyl)phenyl)acetic acid |
| QV1R DXFFF |
| MFCD00004352 |
| 4-(Trifluoromethyl)benzeneacetic acid |
| 4-trifluorometylphenylacetic acid |
| 4-(Trifluoromethyl)phenylacetic acid |
