Introduction:Basic information about CAS 1012341-50-2|(2R,4S)-5-(Biphenyl-4-yl)-4-[(tert-butoxycarbonyl)amino]-2-methylpentanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2R,4S)-5-(Biphenyl-4-yl)-4-[(tert-butoxycarbonyl)amino]-2-methylpentanoic acid |
|---|
| CAS Number | 1012341-50-2 | Molecular Weight | 383.481 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 582.6±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H29NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 306.2±30.1 °C |
|---|
Names
| Name | (2R,4S)-5-([1,1-biphenyl]-4-yl)-4-((tert-butoxycarbonyl)amino)-2-methylpentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 582.6±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H29NO4 |
|---|
| Molecular Weight | 383.481 |
|---|
| Flash Point | 306.2±30.1 °C |
|---|
| Exact Mass | 383.209656 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 5.25 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.546 |
|---|
| InChIKey | YNELJETWNMPEEH-UZLBHIALSA-N |
|---|
| SMILES | CC(CC(Cc1ccc(-c2ccccc2)cc1)NC(=O)OC(C)(C)C)C(=O)O |
|---|
| Water Solubility | Insuluble (3.1E-3 g/L) (25 ºC) |
|---|
Synonyms
| (2R,4S)-5-([1,1'-biphenyl]-4-yl)-4-((tert-butoxycarbonyl)amino)-2-methylpentanoic acid |
| (2R,4S)-5-(4-Biphenylyl)-2-methyl-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)pentanoic acid |
| [1,1'-Biphenyl]-4-pentanoic acid, γ-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-, (αR,γS)- |
| (2R,4S)-5-(Biphenyl-4-yl)-4-[(tert-butoxycarbonyl)amino]-2-methylpentanoic acid |