Introduction:Basic information about CAS 29739-88-6|N-(p-Tosyl)-L-phenylalaninyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(p-Tosyl)-L-phenylalaninyl chloride |
|---|
| CAS Number | 29739-88-6 | Molecular Weight | 337.82100 |
|---|
| Density | 1.304g/cm3 | Boiling Point | 492.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16ClNO3S | Melting Point | 132 °C (dec.)(lit.) |
|---|
| MSDS | / | Flash Point | 251.4ºC |
|---|
Names
| Name | (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.304g/cm3 |
|---|
| Boiling Point | 492.1ºC at 760 mmHg |
|---|
| Melting Point | 132 °C (dec.)(lit.) |
|---|
| Molecular Formula | C16H16ClNO3S |
|---|
| Molecular Weight | 337.82100 |
|---|
| Flash Point | 251.4ºC |
|---|
| Exact Mass | 337.05400 |
|---|
| PSA | 71.62000 |
|---|
| LogP | 4.12170 |
|---|
| Vapour Pressure | 7.91E-10mmHg at 25°C |
|---|
| Index of Refraction | 10 ° (C=3, CHCl3) |
|---|
| InChIKey | KISOIDIHUAPEON-HNNXBMFYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)Cl)cc1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S22-S26-S27-S36/37/39-S45 |
|---|
| RIDADR | UN 3261 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| (S)-3-phenyl-2-(toluene-4-sulfonylamino)propionyl chloride |
| N-p-toluenesulphonyl-L-phenylalanyl chloride |
| (S)-2-(4-methylphenylsulfonamido)-3-phenylpropanoyl chloride |
| N-(p-toluenesulfonyl)-S-phenylalanine chloride |
| Tosyl-L-phenylalanyl Chloride |
| MFCD00191583 |
| (S)-N-(p-tosyl)phenylalaninyl chloride |
| 3-phenyl-2-(toluene-4-sulfonylamino)-propionyl chloride |
| N-p-Tosyl-L-phenylalaninyl chloride |
| N-(p-toluenesulfonyl)-L-phenylalanyl chloride |