Introduction:Basic information about CAS 423-65-4|1h,1h-perfluoro-1-dodecanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1h,1h-perfluoro-1-dodecanol |
|---|
| CAS Number | 423-65-4 | Molecular Weight | 600.11500 |
|---|
| Density | 1.714g/cm3 | Boiling Point | 224°C 740mm |
|---|
| Molecular Formula | C12H3F23O | Melting Point | 111-113°C |
|---|
| MSDS | / | Flash Point | 224°C/740mm |
|---|
Names
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.714g/cm3 |
|---|
| Boiling Point | 224°C 740mm |
|---|
| Melting Point | 111-113°C |
|---|
| Molecular Formula | C12H3F23O |
|---|
| Molecular Weight | 600.11500 |
|---|
| Flash Point | 224°C/740mm |
|---|
| Exact Mass | 599.98200 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 6.89400 |
|---|
| Vapour Pressure | 0.0144mmHg at 25°C |
|---|
| Index of Refraction | 1.285 |
|---|
| InChIKey | SHTZQFTXUMCALC-UHFFFAOYSA-N |
|---|
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | F: Flammable;Xi: Irritant; |
|---|
| Safety Phrases | S24/25 |
|---|
| HS Code | 2905590090 |
|---|
Customs
| HS Code | 2905590090 |
|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1H,1H-Perfluoro-1-dodecanol |
| 1H,1H-Tricosafluor-dodecan-1-ol |
| 1,1-Dihydroperfluordodecanol-1 |
| 1H,1H-tricosafluoro-dodecan-1-ol |
| 1h,1h-perfluorododecanol |
| 1H,1H-Perfluorododecan-1-ol |
| perfluorododecanol |
| PC9798 |
| MFCD00153235 |