Introduction:Basic information about CAS 330562-45-3|perfluoro-2,5,6-trioxanonyl bromide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | perfluoro-2,5,6-trioxanonyl bromide |
|---|
| CAS Number | 330562-45-3 | Molecular Weight | 446.94600 |
|---|
| Density | 1.935g/cm3 | Boiling Point | 100ºC |
|---|
| Molecular Formula | C6BrF13O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 73ºC |
|---|
Names
| Name | 1-[2-[bromo(difluoro)methoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.935g/cm3 |
|---|
| Boiling Point | 100ºC |
|---|
| Molecular Formula | C6BrF13O3 |
|---|
| Molecular Weight | 446.94600 |
|---|
| Flash Point | 73ºC |
|---|
| Exact Mass | 445.88200 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 4.87240 |
|---|
| Index of Refraction | 1.311 |
|---|
| InChIKey | JPQGQPTZDXLRAY-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)Br |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
Synonyms
| MFCD03412278 |
| PC5539 |
| 1-Bromoperfluoro-2,5,8-trioxanonane |
| Perfluoro2,5,8trioxanonylbromide |