CAS 17704-22-2|pentavinylpentamethylcyclopentasiloxane
Introduction：Basic information about CAS 17704-22-2|pentavinylpentamethylcyclopentasiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | pentavinylpentamethylcyclopentasiloxane | ||
|---|---|---|---|
| CAS Number | 17704-22-2 | Molecular Weight | 430.823 |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 307.8±25.0 °C at 760 mmHg |
| Molecular Formula | C15H30O5Si5 | Melting Point | -140ºC |
| MSDS | / | Flash Point | 129.4±23.6 °C |
Names
| Name | pentavinylpentamethylcyclopentasiloxane |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 307.8±25.0 °C at 760 mmHg |
| Melting Point | -140ºC |
| Molecular Formula | C15H30O5Si5 |
| Molecular Weight | 430.823 |
| Flash Point | 129.4±23.6 °C |
| Exact Mass | 430.093964 |
| PSA | 46.15000 |
| LogP | 4.06900 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.459 |
| InChIKey | ZBXBDQPVXIIXJS-UHFFFAOYSA-N |
| SMILES | C=C[Si]1(C)O[Si](C)(C=C)O[Si](C)(C=C)O[Si](C)(C=C)O[Si](C)(C=C)O1 |
Safety Information
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
Synonyms
| Cyclopentasiloxane,2,4,6,8,10-pentaethenyl-2,4,6,8,10-pentamethyl |
| Methylvinylsiloxane cyclic pentamer |
| 2,4,6,8,10-Pentaethenyl-2,4,6,8,10-pentamethylcyclodecanepentasiloxane |
| Einecs 241-712-3 |
| 1,3,5,7,9-Pentavinyl-1,3,5,7,9-pentamethylcyclopentasiloxane |
| 2,4,6,8,10-Pentamethyl-2,4,6,8,10-pentavinyl-1,3,5,7,9,2,4,6,8,10-pentoxapentasilecane |
| 2,4,6,8,10-pentaethenyl-2,4,6,8,10-pentamethyl-cyclopentasiloxan |
| Cyclopentasiloxane, 2,4,6,8,10-pentaethenyl-2,4,6,8,10-pentamethyl- |
| Pentamethylpentavinylcyclopentasiloxane |
| 2,4,6,8,10-pentamethyl-2,4,6,8,10-pentavinyl-cyclopentasiloxane |
