Introduction:Basic information about CAS 93-00-5|6-Amino-2-naphthalenesulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Amino-2-naphthalenesulfonic acid |
|---|
| CAS Number | 93-00-5 | Molecular Weight | 223.248 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 500ºC |
|---|
| Molecular Formula | C10H9NO3S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | 6-aminonaphthalene-2-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 500ºC |
|---|
| Molecular Formula | C10H9NO3S |
|---|
| Molecular Weight | 223.248 |
|---|
| Exact Mass | 223.030319 |
|---|
| PSA | 88.77000 |
|---|
| LogP | 0.42 |
|---|
| Index of Refraction | 1.713 |
|---|
| InChIKey | SEMRCUIXRUXGJX-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc2cc(S(=O)(=O)O)ccc2c1 |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2921450090 |
|---|
Customs
| HS Code | 2921450090 |
|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| MFCD00035736 |
| 6-Amino-2-naphthalenesulfonic Acid Monohydrate |
| 2-Naphthalenesulfonic acid, 6-amino- |
| 6-Amino-2-naphthalenesulfonic acid |
| 6-aminonaphthalene-2-sulfonic acid |
| EINECS 202-208-9 |