Introduction:Basic information about CAS 60461-13-4|L-Methionine,N-(N-formyl-L-phenylalanyl)- (9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | L-Methionine,N-(N-formyl-L-phenylalanyl)- (9CI) |
|---|
| CAS Number | 60461-13-4 | Molecular Weight | 324.39500 |
|---|
| Density | 1.251g/cm3 | Boiling Point | 692.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H20N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 372.7ºC |
|---|
Names
| Name | 2-[(2-formamido-3-phenylpropanoyl)amino]-4-methylsulfanylbutanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.251g/cm3 |
|---|
| Boiling Point | 692.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H20N2O4S |
|---|
| Molecular Weight | 324.39500 |
|---|
| Flash Point | 372.7ºC |
|---|
| Exact Mass | 324.11400 |
|---|
| PSA | 120.80000 |
|---|
| LogP | 2.08390 |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | QXQWSZPNISDOON-UHFFFAOYSA-N |
|---|
| SMILES | CSCCC(NC(=O)C(Cc1ccccc1)NC=O)C(=O)O |
|---|