Introduction：Basic information about CAS 76310-14-0|Met-Enkephalin-Arg, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Met-Enkephalin-Arg |
|---|
| CAS Number | 76310-14-0 | Molecular Weight | 729.84700 |
|---|
| Density | 1.41 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C33H47N9O8S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[2-[[2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.41 g/cm3 |
|---|
| Molecular Formula | C33H47N9O8S |
|---|
| Molecular Weight | 729.84700 |
|---|
| Exact Mass | 729.32700 |
|---|
| PSA | 316.25000 |
|---|
| LogP | 2.13820 |
|---|
| Index of Refraction | 1.649 |
|---|
| InChIKey | UCBRMNXTPDDSKN-CQJMVLFOSA-N |
|---|
| SMILES | CSCCC(NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
|---|
Synonyms
| 6-Arg-met-enkephalin |
| Enkephalin-met,arginine(6) |
| Met-enkephalin,arg(6) |
| L-Arginine,N2-(N-(N-(N-(N-L-tyrosylglycyl)glycyl)-L-phenylalanyl)-L-methionyl) |
| Methionine-enkephalin,arg(6) |
| Enkephalin-met,arg(6) |
| Met-enk-A |
| Met-Enkephalin-Arg |
