Introduction：Basic information about CAS 1026-92-2|Diallyl terephthalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diallyl terephthalate |
|---|
| CAS Number | 1026-92-2 | Molecular Weight | 246.259 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 349.9±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 171.3±20.7 °C |
|---|
Names
| Name | bis(prop-2-enyl) benzene-1,4-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 349.9±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H14O4 |
|---|
| Molecular Weight | 246.259 |
|---|
| Flash Point | 171.3±20.7 °C |
|---|
| Exact Mass | 246.089203 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 4.13 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.524 |
|---|
| InChIKey | ZDNFTNPFYCKVTB-UHFFFAOYSA-N |
|---|
| SMILES | C=CCOC(=O)c1ccc(C(=O)OCC=C)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| RIDADR | UN 2810 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Diallylterephthalat |
| Diallyl terephthalate |
| terephthalic acid diallyl ester |
| Terephthalsaeure-diallylester |
| 1,4-Benzenedicarboxylic acid,di-2-propenyl ester |
| EINECS 213-835-2 |
| diprop-2-en-1-yl benzene-1,4-dicarboxylate |
| 1,4-Benzenedicarboxylic acid, di-2-propen-1-yl ester |
| Diallyl terethiolate |
| p-CH2CHCH2OOCC6H4COOCH2CHCH2 |
