Introduction:Basic information about CAS 668471-48-5|4-(2,4-DICHLOROPHENYL)-5-(1-METHYL-1H-PYRROL-2-YL)-4H-1,2,4-TRIAZOLE-3-THIOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2,4-DICHLOROPHENYL)-5-(1-METHYL-1H-PYRROL-2-YL)-4H-1,2,4-TRIAZOLE-3-THIOL |
|---|
| CAS Number | 668471-48-5 | Molecular Weight | 325.21600 |
|---|
| Density | 1.52g/cm3 | Boiling Point | 448.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10Cl2N4S | Melting Point | 252ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-(2,4-dichlorophenyl)-3-(1-methylpyrrol-2-yl)-1H-1,2,4-triazole-5-thione |
|---|
Chemical & Physical Properties
| Density | 1.52g/cm3 |
|---|
| Boiling Point | 448.1ºC at 760 mmHg |
|---|
| Melting Point | 252ºC |
|---|
| Molecular Formula | C13H10Cl2N4S |
|---|
| Molecular Weight | 325.21600 |
|---|
| Exact Mass | 324.00000 |
|---|
| PSA | 74.44000 |
|---|
| LogP | 3.86830 |
|---|
| Index of Refraction | 1.727 |
|---|
| InChIKey | HCYUQBPZHFIYSE-UHFFFAOYSA-N |
|---|
| SMILES | Cn1cccc1-c1n[nH]c(=S)n1-c1ccc(Cl)cc1Cl |
|---|