Introduction:Basic information about CAS 107367-98-6|2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetic acid |
|---|
| CAS Number | 107367-98-6 | Molecular Weight | 217.22100 |
|---|
| Density | 1.245g/cm3 | Boiling Point | 411.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H11NO3 | Melting Point | 131ºC |
|---|
| MSDS | / | Flash Point | 202.8ºC |
|---|
Names
| Name | 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.245g/cm3 |
|---|
| Boiling Point | 411.7ºC at 760mmHg |
|---|
| Melting Point | 131ºC |
|---|
| Molecular Formula | C12H11NO3 |
|---|
| Molecular Weight | 217.22100 |
|---|
| Flash Point | 202.8ºC |
|---|
| Exact Mass | 217.07400 |
|---|
| PSA | 63.33000 |
|---|
| LogP | 2.27710 |
|---|
| Vapour Pressure | 1.63E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | XEWJNPORMBGGKZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1oc(-c2ccccc2)nc1CC(=O)O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-(3,5-DIMETHYL-PYRAZOL-1-YL)-BUTYRIC ACID |
| 2-Phenyl-5-methyloxazol-4-ylacetic acid |
| (5-methyl-2-phenyl-1,3-oxazol-4-yl)acetic acid |
| 4-(2-phenyl-5-methyl)-oxazolyl-acetic acid |
| (5-methyl-2-phenyl-oxazol-4-yl)-acetic acid |
| 2-(5-Methyl-2-phenyl-4-oxazolyl)-acetic acid |
| 2-(5-methyl-2-phenyloxazol-4-yl)acetic acid |
| MFCD00100005 |