Introduction：Basic information about CAS 222180-23-6|3'-FORMYL-[1,1'-BIPHENYL]-4-CARBOXYLIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3'-FORMYL-[1,1'-BIPHENYL]-4-CARBOXYLIC ACID |
|---|
| CAS Number | 222180-23-6 | Molecular Weight | 226.22700 |
|---|
| Density | 1.264g/cm3 | Boiling Point | 441.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10O3 | Melting Point | 231ºC |
|---|
| MSDS | / | Flash Point | 235.2ºC |
|---|
Names
| Name | 4-(3-formylphenyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.264g/cm3 |
|---|
| Boiling Point | 441.9ºC at 760 mmHg |
|---|
| Melting Point | 231ºC |
|---|
| Molecular Formula | C14H10O3 |
|---|
| Molecular Weight | 226.22700 |
|---|
| Flash Point | 235.2ºC |
|---|
| Exact Mass | 226.06300 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 2.86430 |
|---|
| Vapour Pressure | 1.37E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | ZIJAWDBNCZHVRY-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1cccc(-c2ccc(C(=O)O)cc2)c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 3'-formylbiphenyl-4-carboxylic acid |
| 3'-formyl[1,1'-biphenyl]-4-carboxylic acid |
