Introduction：Basic information about CAS 1787-44-6|triphenyl(trideuteriomethyl)phosphanium,bromide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | triphenyl(trideuteriomethyl)phosphanium,bromide |
|---|
| CAS Number | 1787-44-6 | Molecular Weight | 360.24200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H15BrD3P | Melting Point | 233-235ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | triphenyl(trideuteriomethyl)phosphanium,bromide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 233-235ºC(lit.) |
|---|
| Molecular Formula | C19H15BrD3P |
|---|
| Molecular Weight | 360.24200 |
|---|
| Exact Mass | 359.05200 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 0.61430 |
|---|
| InChIKey | LSEFCHWGJNHZNT-NIIDSAIPSA-M |
|---|
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| <D3>-Methyltriphenylphosphiniumbromid |
| EINECS 217-248-2 |
| MFCD00064524 |
