Introduction：Basic information about CAS 2921-92-8|propylidynetrimethyl trinitrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | propylidynetrimethyl trinitrate |
|---|
| CAS Number | 2921-92-8 | Molecular Weight | 269.16600 |
|---|
| Density | 1.454g/cm3 | Boiling Point | 356ºC at 760mmHg |
|---|
| Molecular Formula | C6H11N3O9 | Melting Point | 51-52° |
|---|
| MSDS | / | Flash Point | 159ºC |
|---|
Names
| Name | 2,2-bis(nitrooxymethyl)butyl nitrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.454g/cm3 |
|---|
| Boiling Point | 356ºC at 760mmHg |
|---|
| Melting Point | 51-52° |
|---|
| Molecular Formula | C6H11N3O9 |
|---|
| Molecular Weight | 269.16600 |
|---|
| Flash Point | 159ºC |
|---|
| Exact Mass | 269.05000 |
|---|
| PSA | 165.15000 |
|---|
| LogP | 1.57730 |
|---|
| Vapour Pressure | 6.17E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.485 |
|---|
| InChIKey | YZZCJYJBCUJISI-UHFFFAOYSA-N |
|---|
| SMILES | CCC(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-] |
|---|
Synonyms
| Propatilnitrato |
| Propatylnitratum |
| 1-nitryloxy-2,2-bis-nitryloxymethyl-butane |
| ETTN |
| UNII-AJT2YN495R |
| Propatyl nitrate |
