Introduction：Basic information about CAS 2809-64-5|5-METHYLTETRALIN, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-METHYLTETRALIN |
|---|
| CAS Number | 2809-64-5 | Molecular Weight | 146.229 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 232.0±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H14 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 94.2±7.3 °C |
|---|
Names
| Name | 5-methyl-1,2,3,4-tetrahydronaphthalene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 232.0±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H14 |
|---|
| Molecular Weight | 146.229 |
|---|
| Flash Point | 94.2±7.3 °C |
|---|
| Exact Mass | 146.109543 |
|---|
| LogP | 4.36 |
|---|
| Vapour Pressure | 0.1±0.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.540 |
|---|
| InChIKey | YXOVIGZJPGLNGM-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc2c1CCCC2 |
|---|
Synonyms
| 5-methyl-1,2,3,4-tetrahydro-naphthalene |
| 1-methyltetralin |
| 1,2,3,4-tetrahydro-5-methyl-naphthalene |
| 5-Methyl-1,2,3,4-tetrahydronaphthalin |
| InChI=1/C11H14/c1-9-5-4-7-10-6-2-3-8-11(9)10/h4-5,7H,2-3,6,8H2,1H |
| Naphthalene,1,2,3,4-tetrahydro-5-methyl |
| 5-Methyl-1,2,3,4-tetrahydronaphthalene |
| 5-METHYLTETRALIN |
| Naphthalene, 1,2,3,4-tetrahydro-5-methyl- |
