Introduction：Basic information about CAS 29027-13-2|2-Methoxy-1-methyl-3,5-dinitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methoxy-1-methyl-3,5-dinitrobenzene |
|---|
| CAS Number | 29027-13-2 | Molecular Weight | 212.160 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 369.8±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H8N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 183.5±28.5 °C |
|---|
Names
| Name | 2-methoxy-1-methyl-3,5-dinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 369.8±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H8N2O5 |
|---|
| Molecular Weight | 212.160 |
|---|
| Flash Point | 183.5±28.5 °C |
|---|
| Exact Mass | 212.043320 |
|---|
| PSA | 100.87000 |
|---|
| LogP | 2.02 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | XCHBHMOBNNBYAX-UHFFFAOYSA-N |
|---|
| SMILES | COc1c(C)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2-Methyl-4,6-dinitroanisol |
| 2.4-Dinitro-6-methylanisol |
| 3.5-Dinitro-2-methoxy-toluol |
| Methyl-(4.6-dinitro-2-methyl-phenyl)-aether |
| 2,4-DIBROMO-16A-HYDROXYESTRONE |
| 2-Methoxy-1-methyl-3,5-dinitrobenzene |
| Benzene, 2-methoxy-1-methyl-3,5-dinitro- |
| 2-methyl-4,6-dinitro-anisole |
