Introduction：Basic information about CAS 28162-02-9|Hydroquinone, mono(p-cyanobenzoate) (8CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hydroquinone, mono(p-cyanobenzoate) (8CI) |
|---|
| CAS Number | 28162-02-9 | Molecular Weight | 239.22600 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 463.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H9NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 234.3ºC |
|---|
Names
| Name | Hydroquinone, mono(p-cyanobenzoate) (8CI) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 463.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H9NO3 |
|---|
| Molecular Weight | 239.22600 |
|---|
| Flash Point | 234.3ºC |
|---|
| Exact Mass | 239.05800 |
|---|
| PSA | 70.32000 |
|---|
| LogP | 2.48308 |
|---|
| Vapour Pressure | 3.16E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | UPMIMMYULADZDF-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1ccc(C(=O)Oc2ccc(O)cc2)cc1 |
|---|
Synonyms
| Chinol-mono-p-cyanobenzoat |
| Benzoic acid,4-cyano-,4-hydroxyphenyl ester |
| 4-cyano |
