Introduction：Basic information about CAS 109306-21-0|(+)-4,5-Bis[hydroxy(diphenyl)methyl]-2-methyl-2-phenyl-1,3-dioxolane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (+)-4,5-Bis[hydroxy(diphenyl)methyl]-2-methyl-2-phenyl-1,3-dioxolane |
|---|
| CAS Number | 109306-21-0 | Molecular Weight | 528.637 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 701.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C36H32O4 | Melting Point | 120 °C |
|---|
| MSDS | / | Flash Point | 378.3±31.5 °C |
|---|
Names
| Name | (+)-4,5-Bis[hydroxy(diphenyl)methyl]-2-methyl-2-phenyl-1,3-dioxolane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 701.9±55.0 °C at 760 mmHg |
|---|
| Melting Point | 120 °C |
|---|
| Molecular Formula | C36H32O4 |
|---|
| Molecular Weight | 528.637 |
|---|
| Flash Point | 378.3±31.5 °C |
|---|
| Exact Mass | 528.230042 |
|---|
| PSA | 58.92000 |
|---|
| LogP | 11.64 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | QVQMFUMIQACODH-CZNDPXEESA-N |
|---|
| SMILES | CC1(c2ccccc2)OC(C(O)(c2ccccc2)c2ccccc2)C(C(O)(c2ccccc2)c2ccccc2)O1 |
|---|
Synonyms
| (2R,3R)-1,1,4,4-Tetraphenyl-2,3-O-(1-phenylethylidene)-1,2,3,4-butanetetrol |
| (+)-4,5-Bis[hydroxy(diphenyl)Methyl]-2-Methyl-2-phenyl-1,3-dioxolane |
| (2R,3R)-2,3-O-(1-Phenylethylidene)-1,1,4,4-tetraphenyl-1,2,3,4-butanetetrol |
| [(4R,5R)-2-Methyl-2-phenyl-1,3-dioxolane-4,5-diyl]bis(diphenylmethanol) |
| 1,3-Dioxolane-4,5-dimethanol, 2-methyl-α,α,α,α,2-pentaphenyl-, (4R,5R)- |
