Introduction：Basic information about CAS 4835-39-6|N-(4-Nitrophenyl)-3-oxobutyramide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(4-Nitrophenyl)-3-oxobutyramide |
|---|
| CAS Number | 4835-39-6 | Molecular Weight | 222.19700 |
|---|
| Density | 1.331 g/cm3 | Boiling Point | 498.6ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10N2O4 | Melting Point | 119-124°C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-(4-nitrophenyl)-3-oxobutanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.331 g/cm3 |
|---|
| Boiling Point | 498.6ºC at 760 mmHg |
|---|
| Melting Point | 119-124°C |
|---|
| Molecular Formula | C10H10N2O4 |
|---|
| Molecular Weight | 222.19700 |
|---|
| Exact Mass | 222.06400 |
|---|
| PSA | 91.99000 |
|---|
| LogP | 2.10860 |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | KCXJQNDNGLRYBN-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)CC(=O)Nc1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-(4-nitrophenyl)-2-acetylacetamide |
| p-nitro acetoacetanilide |
| Acetoacet-p-nitroanilide(AAPNA) |
| N-para-nitrophenylacetoacetamide |
| 4'-Nitroacetoacetanilide |
| N-(4-nitrophenyl)acetoacetamide |
| n-(4-nitro-phenyl)-3-oxo-butyramide |
| N-(4-Nitrophenyl)-3-oxobutyramide |
