Introduction:Basic information about CAS 93957-49-4|1-Isopropyl-3-(4-fluorophenyl)-indole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Isopropyl-3-(4-fluorophenyl)-indole |
|---|
| CAS Number | 93957-49-4 | Molecular Weight | 253.314 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 389.6±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H16FN | Melting Point | 96-97°C |
|---|
| MSDS | / | Flash Point | 189.4±23.2 °C |
|---|
Names
| Name | 3-(4-Fluorophenyl)-1-isopropyl-1H-indole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 389.6±25.0 °C at 760 mmHg |
|---|
| Melting Point | 96-97°C |
|---|
| Molecular Formula | C17H16FN |
|---|
| Molecular Weight | 253.314 |
|---|
| Flash Point | 189.4±23.2 °C |
|---|
| Exact Mass | 253.126678 |
|---|
| PSA | 4.93000 |
|---|
| LogP | 5.11 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | ZDZJOIIBECYKAJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)n1cc(-c2ccc(F)cc2)c2ccccc21 |
|---|
| Storage condition | Room temperature. |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36-S61 |
|---|
Synonyms
| 3-(4-fluorophenyl)-1-propan-2-ylindole |
| 1-Isopropyl-3-(4-fluorophenyl)-indole |
| MFCD01075733 |
| 3-(4-Fluorophenyl)-1-(propan-2-yl)-1H-indole |
| T56 BNJ BY1&1 DR DF |
| 1H-Indole, 3-(4-fluorophenyl)-1-(1-methylethyl)- |
| 3-(4-Fluorophenyl)-1-isopropyl-1H-indole |
| EINECS 418-790-4 |
| 3-(4-FLUOROPHENYL)-1-(1-METHYLETHYL)-1H-INDOLE |
| 1-Isopropyl-3-(4-fluorophenyl)indole |