Introduction：Basic information about CAS 24317-95-1|ethyl 2-acetyl decanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 2-acetyl decanoate |
|---|
| CAS Number | 24317-95-1 | Molecular Weight | 242.35400 |
|---|
| Density | 0.929g/cm3 | Boiling Point | 279.8ºC at 760mmHg |
|---|
| Molecular Formula | C14H26O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 113.5ºC |
|---|
Names
| Name | Ethyl 2-acetyldecanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.929g/cm3 |
|---|
| Boiling Point | 279.8ºC at 760mmHg |
|---|
| Molecular Formula | C14H26O3 |
|---|
| Molecular Weight | 242.35400 |
|---|
| Flash Point | 113.5ºC |
|---|
| Exact Mass | 242.18800 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 3.50530 |
|---|
| Vapour Pressure | 0.00393mmHg at 25°C |
|---|
| Index of Refraction | 1.439 |
|---|
| InChIKey | APTZVOCKCUIHMY-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCC(C(C)=O)C(=O)OCC |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| ethyl 2-octyl-3-oxobutanoate |
| 2-Octyl-acetessigsaeure-aethylester |
| 2-acetyl-decanoic acid,ethyl ester |
| EINECS 246-158-6 |
| Decanoic acid,2-acetyl-,ethyl ester |
| 2-octyl-acetoacetic acid ethyl ester |
| ethyl 2-octylacetoacetate |
