Introduction：Basic information about CAS 527-76-4|4-amino-2-sulfobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-amino-2-sulfobenzoic acid |
|---|
| CAS Number | 527-76-4 | Molecular Weight | 217.19900 |
|---|
| Density | 1.71g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H7NO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-amino-2-sulfobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.71g/cm3 |
|---|
| Molecular Formula | C7H7NO5S |
|---|
| Molecular Weight | 217.19900 |
|---|
| Exact Mass | 217.00400 |
|---|
| PSA | 126.07000 |
|---|
| LogP | 1.87570 |
|---|
| Index of Refraction | 1.662 |
|---|
| InChIKey | YPNUYFJLBFZDTE-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(C(=O)O)c(S(=O)(=O)O)c1 |
|---|
Safety Information
Customs
| HS Code | 2922499990 |
|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-Amino-benzoesaeure-sulfonsaeure-(2) |
| 1-amino-4-carboxybenzene-3-sulfonic acid |
| 4-Amino-2-sulfobenzoicacid |
| p-Amino-o-sulfobenzoic acid |
| Benzoic acid,4-amino-2-sulfo |
| MFCD07779293 |
| 4-Amino-2-sulfo-benzoesaeure |
