Introduction：Basic information about CAS 170791-09-0|Trityl Candesartan Cilexetil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Trityl Candesartan Cilexetil |
|---|
| CAS Number | 170791-09-0 | Molecular Weight | 852.974 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C52H48N6O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-cyclohexyloxycarbonyloxyethyl 2-ethoxy-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Molecular Formula | C52H48N6O6 |
|---|
| Molecular Weight | 852.974 |
|---|
| Exact Mass | 852.363525 |
|---|
| PSA | 132.48000 |
|---|
| LogP | 12.93 |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | MOHQWFWIPOOTGV-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1nc2cccc(C(=O)OC(C)OC(=O)OC3CCCCC3)c2n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
|---|
Safety Information
Synonyms
| trityl condesartan cilexetil |
| 1-{[(Cyclohexyloxy)carbonyl]oxy}ethyl 2-ethoxy-1-{[2'-(1-trityl-1H-tetrazol-5-yl)-4-biphenylyl]methyl}-1H-benzimidazole-7-carboxylate |
| 1-{[(Cyclohexyloxy)carbonyl]oxy}ethyl 2-ethoxy-1-{[2'-(1-trityl-1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1H-benzimidazole-7-carboxylate |
| Trityl Candesartan Cilexetil |
| UNII:006A6A2YSO |
| 1H-Benzimidazole-7-carboxylic acid, 2-ethoxy-1-[[2'-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-, 1-[[(cyclohexyloxy)carbonyl]oxy]ethyl ester |
| UNII-006A6A2YSO |
| N-Trityl Candesartan Cilexetil |
| Candesartan Cilexetil Impurity 8 |
