Introduction：Basic information about CAS 69286-06-2|2,2'-Bi-1H-imidazole,4,4',5,5'-tetramethyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2'-Bi-1H-imidazole,4,4',5,5'-tetramethyl- |
|---|
| CAS Number | 69286-06-2 | Molecular Weight | 190.24500 |
|---|
| Density | 1.167g/cm3 | Boiling Point | 467.1ºC at 760 mmHg |
|---|
| Molecular Formula | C10H14N4 | Melting Point | >300ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 227ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-(4,5-dimethyl-1H-imidazol-2-yl)-4,5-dimethyl-1H-imidazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.167g/cm3 |
|---|
| Boiling Point | 467.1ºC at 760 mmHg |
|---|
| Melting Point | >300ºC(lit.) |
|---|
| Molecular Formula | C10H14N4 |
|---|
| Molecular Weight | 190.24500 |
|---|
| Flash Point | 227ºC |
|---|
| Exact Mass | 190.12200 |
|---|
| PSA | 57.36000 |
|---|
| LogP | 2.03340 |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | YDDBHCXOIBPIFS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(-c2nc(C)c(C)[nH]2)[nH]c1C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 4,5,4',5'-tetramethyl-2,2'-biimidazole |
| 4,5,4',5'-tetramethylbiimidazole |
| 2,2'-Bi-1H-imidazole,4,4',5,5'-tetramethyl |
| EINECS 273-955-6 |
| 2,2',4,4'-tetramethylbiimidazole |
| 2,2'-BIPYRIDINE-5-CARBALDEHYDE |
| 4,4',5,5'-tetramethyl-2,2'-bi-1H-imidazole |
| 2,2'-bis(4,5-dimethylimidazolyl) |
| 2,2'-Bis(4,5-dimethylimidazole) |
| MFCD00005202 |
