Introduction：Basic information about CAS 24864-19-5|4-(4-Biphenylyl)-2-methyl-1,3-thiazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-Biphenylyl)-2-methyl-1,3-thiazole |
|---|
| CAS Number | 24864-19-5 | Molecular Weight | 251.34600 |
|---|
| Density | 1.147g/cm3 | Boiling Point | 431.3ºC at 760mmHg |
|---|
| Molecular Formula | C16H13NS | Melting Point | 113-118ºC |
|---|
| MSDS | / | Flash Point | 218.3ºC |
|---|
Names
| Name | 2-methyl-4-(4-phenylphenyl)-1,3-thiazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.147g/cm3 |
|---|
| Boiling Point | 431.3ºC at 760mmHg |
|---|
| Melting Point | 113-118ºC |
|---|
| Molecular Formula | C16H13NS |
|---|
| Molecular Weight | 251.34600 |
|---|
| Flash Point | 218.3ºC |
|---|
| Exact Mass | 251.07700 |
|---|
| PSA | 41.13000 |
|---|
| LogP | 4.78550 |
|---|
| Vapour Pressure | 3.05E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | OKOZRTTWERNRQS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(-c2ccc(-c3ccccc3)cc2)cs1 |
|---|
Safety Information
| Safety Phrases | S24/25 |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 4-(4-Biphenylyl)-2-methylthiazole |
| 4-Biphenyl-4-yl-2-methyl-thiazol |
| 4-(4-Biphenylyl)-2-methyl-1,3-thiazole |
| 4-biphenyl-4-yl-2-methyl-thiazole |
| 4-(biphenyl-4-yl)-2-methyl-1,3-thiazole |
| Thiazole,4-(4-biphenylyl)-2-methyl |
| 2-Methyl-4-p-biphenylyl-thiazol |
| EINECS 246-505-1 |
| MFCD00005333 |
