Introduction：Basic information about CAS 2245-53-6|2,2'-[1,4-Phenylenebis(oxy)]diacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2'-[1,4-Phenylenebis(oxy)]diacetic acid |
|---|
| CAS Number | 2245-53-6 | Molecular Weight | 226.183 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 449.7±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H10O6 | Melting Point | 248-251 °C |
|---|
| MSDS | / | Flash Point | 181.3±16.7 °C |
|---|
Names
| Name | hydroquinone-o,o'-diacetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 449.7±25.0 °C at 760 mmHg |
|---|
| Melting Point | 248-251 °C |
|---|
| Molecular Formula | C10H10O6 |
|---|
| Molecular Weight | 226.183 |
|---|
| Flash Point | 181.3±16.7 °C |
|---|
| Exact Mass | 226.047745 |
|---|
| PSA | 93.06000 |
|---|
| LogP | 0.51 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | DNXOCFKTVLHUMU-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)COc1ccc(OCC(=O)O)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S37/39-S26 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| q-linker |
| 2,2'-[1,4-Phenylenebis(oxy)]diacetic acid |
| benzene-1,4-dioxydiacetic acid |
| Hydroquinone-O,O'-diacetic acid |
| Acetic acid, 2,2'-[1,4-phenylenebis(oxy)]bis- |
| Hydroquinone-O,O′-diacetic acid |
| EINECS 218-834-0 |
| MFCD00016816 |
| HYDROQUINONE-2,2'-DIACETIC ACID |
| hydroquinone-O,O'-dioxydiacetic acid |
| 2,2'-(1,4-Phenylenebis(oxy))diacetic acid |
