Introduction：Basic information about CAS 66640-58-2|3-Methylsulfonyl-2,2',3',4',5-pentachlorobiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Methylsulfonyl-2,2',3',4',5-pentachlorobiphenyl |
|---|
| CAS Number | 66640-58-2 | Molecular Weight | 404.52300 |
|---|
| Density | 1.578g/cm3 | Boiling Point | 531.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H7Cl5O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 275.1ºC |
|---|
Names
| Name | 1,2,3-trichloro-4-(2,5-dichloro-3-methylsulfonylphenyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.578g/cm3 |
|---|
| Boiling Point | 531.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H7Cl5O2S |
|---|
| Molecular Weight | 404.52300 |
|---|
| Flash Point | 275.1ºC |
|---|
| Exact Mass | 401.86100 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 7.10490 |
|---|
| Index of Refraction | 1.611 |
|---|
| InChIKey | FIQRAZWPOIJSBP-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1cc(Cl)cc(-c2ccc(Cl)c(Cl)c2Cl)c1Cl |
|---|
Synonyms
| 1,1'-Biphenyl,2,2',3,4,5'-pentachloro-3'-(methylsulfonyl) |
| 2,2',3,4,5'-pentachloro-3'-(methylsulfonyl)biphenyl |
| 2,2',3,4,5'-Pentachloro-3'-(methylsulfonyl)-1,1'-biphenyl |
