Introduction：Basic information about CAS 6665-71-0|5-hydroxy-2'-methoxyflavone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-hydroxy-2'-methoxyflavone |
|---|
| CAS Number | 6665-71-0 | Molecular Weight | 268.26400 |
|---|
| Density | 1.329g/cm3 | Boiling Point | 465.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177.5ºC |
|---|
Names
| Name | 5-hydroxy-2'-methoxyflavone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.329g/cm3 |
|---|
| Boiling Point | 465.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H12O4 |
|---|
| Molecular Weight | 268.26400 |
|---|
| Flash Point | 177.5ºC |
|---|
| Exact Mass | 268.07400 |
|---|
| PSA | 59.67000 |
|---|
| LogP | 3.17420 |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | OHYPQURAHPKQEA-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccccc1-c1cc(=O)c2c(O)cccc2o1 |
|---|
Safety Information
Customs
| HS Code | 2914509090 |
|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 5-hydroxy-2-(2-hydroxy-phenyl)-chromen-4-one |
| 2',5-Dihydroxyflavon |
| 5-hydroxy-2-(2-methoxyphenyl)-chromen-4-one |
| 5-Hydroxy-2'-methoxy-flavon |
| 5-hydroxy-2-(2-methoxyphenyl)-4H-chromen-4-one |
| 5-Hydroxy-2-(2-hydroxy-phenyl)-chromen-4-on |
| 5-Hydroxy-2-(2-methoxy-phenyl)-chromen-4-on |
