Introduction：Basic information about CAS 103300-91-0|Lisinopril ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Lisinopril ester |
|---|
| CAS Number | 103300-91-0 | Molecular Weight | 529.549 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 714.8±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H34F3N3O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 386.1±32.9 °C |
|---|
Names
| Name | N2-1[(1S)-Ethoxycarbonyl-3-phenylpropyl]-N6-trifluoroacetyl-L-lysyl-L-proline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 714.8±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H34F3N3O6 |
|---|
| Molecular Weight | 529.549 |
|---|
| Flash Point | 386.1±32.9 °C |
|---|
| Exact Mass | 529.239990 |
|---|
| PSA | 125.04000 |
|---|
| LogP | 2.89 |
|---|
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.519 |
|---|
| InChIKey | WEPXGLCNGPXOQG-YPJRHXLCSA-N |
|---|
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(CCCCNC(=O)C(F)(F)F)C(=O)N1CCCC1C(=O)O |
|---|
Synonyms
| L-Proline, N-[(1S)-1-(ethoxycarbonyl)-3-phenylpropyl]-N-(2,2,2-trifluoroacetyl)-L-lysyl- |
| lisinopril ester |
| N-[(2S)-1-Ethoxy-1-oxo-4-phenylbutan-2-yl]-N-(trifluoroacetyl)-L-lysyl-L-proline |
| N-[(2S)-1-Ethoxy-1-oxo-4-phenyl-2-butanyl]-N-(trifluoroacetyl)-L-lysyl-L-proline |
