Introduction：Basic information about CAS 4104-47-6|N-Sulfinyl-p-toluenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Sulfinyl-p-toluenesulfonamide |
|---|
| CAS Number | 4104-47-6 | Molecular Weight | 217.26500 |
|---|
| Density | 1.42g/cm3 | Boiling Point | 130-140ºC 0,06mm |
|---|
| Molecular Formula | C7H7NO3S2 | Melting Point | 52-54ºC |
|---|
| MSDS | / | Flash Point | 155.2ºC |
|---|
Names
| Name | 4-methyl-N-sulfinylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.42g/cm3 |
|---|
| Boiling Point | 130-140ºC 0,06mm |
|---|
| Melting Point | 52-54ºC |
|---|
| Molecular Formula | C7H7NO3S2 |
|---|
| Molecular Weight | 217.26500 |
|---|
| Flash Point | 155.2ºC |
|---|
| Exact Mass | 216.98700 |
|---|
| PSA | 104.04000 |
|---|
| LogP | 3.02680 |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | VKTSIMMJOIPMGE-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N=S=O)cc1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2930909090 |
|---|
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-sulfinyl-4-toluenesulfonamide |
| N-Sulfinyl-p-toluenesulfonamide |
| N-sulfinyl-p-toluensulfonamide |
| N-Thionyl-p-toluenesulfonamide |
| N-Sulfinyl-p-toluensulfonamid |
| N-sulfinyl-p-toluene sulfonamide |
