Introduction:Basic information about CAS 101736-47-4|1-ANTHRACEN-9-YL-BUTANE-1,3-DIONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-ANTHRACEN-9-YL-BUTANE-1,3-DIONE |
|---|
| CAS Number | 101736-47-4 | Molecular Weight | 262.30300 |
|---|
| Density | 1.195g/cm3 | Boiling Point | 463.3ºC at 760mmHg |
|---|
| Molecular Formula | C18H14O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 172.3ºC |
|---|
Names
| Name | 1-anthracen-9-ylbutane-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.195g/cm3 |
|---|
| Boiling Point | 463.3ºC at 760mmHg |
|---|
| Molecular Formula | C18H14O2 |
|---|
| Molecular Weight | 262.30300 |
|---|
| Flash Point | 172.3ºC |
|---|
| Exact Mass | 262.09900 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 4.15480 |
|---|
| Vapour Pressure | 9.18E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | HEGRMYBTNIGYIV-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)CC(=O)c1c2ccccc2cc2ccccc12 |
|---|
Synonyms
| 9-anthroylacetone |
| anthracenylacetylacetone |
| 1-Anthracen-9-yl-butane-1,3-dione |
| 9-Anthroyl-aceton |