Introduction:Basic information about CAS 627511-05-1|2-(4-bromophenyl)-1h-pyrrolo[2,3-c]pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-bromophenyl)-1h-pyrrolo[2,3-c]pyridine |
|---|
| CAS Number | 627511-05-1 | Molecular Weight | 273.12800 |
|---|
| Density | 1.546g/cm3 | Boiling Point | 466.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9BrN2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 236.2ºC |
|---|
Names
| Name | 2-(4-bromophenyl)-1h-pyrrolo[2,3-c]pyridine |
|---|
Chemical & Physical Properties
| Density | 1.546g/cm3 |
|---|
| Boiling Point | 466.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9BrN2 |
|---|
| Molecular Weight | 273.12800 |
|---|
| Flash Point | 236.2ºC |
|---|
| Exact Mass | 271.99500 |
|---|
| PSA | 28.68000 |
|---|
| LogP | 3.99240 |
|---|
| Index of Refraction | 1.708 |
|---|
| InChIKey | FRMPLYCBBPBNNU-UHFFFAOYSA-N |
|---|
| SMILES | Brc1ccc(-c2cc3ccncc3[nH]2)cc1 |
|---|