Introduction:Basic information about CAS 108210-73-7|bifeprofen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bifeprofen |
|---|
| CAS Number | 108210-73-7 | Molecular Weight | 400.89900 |
|---|
| Density | 1.209g/cm3 | Boiling Point | 543.8ºC at 760 mmHg |
|---|
| Molecular Formula | C22H25ClN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 282.7ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.209g/cm3 |
|---|
| Boiling Point | 543.8ºC at 760 mmHg |
|---|
| Molecular Formula | C22H25ClN2O3 |
|---|
| Molecular Weight | 400.89900 |
|---|
| Flash Point | 282.7ºC |
|---|
| Exact Mass | 400.15500 |
|---|
| PSA | 49.85000 |
|---|
| LogP | 3.30350 |
|---|
| Vapour Pressure | 6.92E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.572 |
|---|
| InChIKey | UGBNNXAIXQVUOI-UHFFFAOYSA-N |
|---|
| SMILES | CC(C(=O)OCC(=O)N1CCN(C)CC1)c1ccc(-c2ccccc2Cl)cc1 |
|---|