Introduction：Basic information about CAS 105051-87-4|Minamestane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Minamestane |
|---|
| CAS Number | 105051-87-4 | Molecular Weight | 297.39100 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 499.4ºC at 760mmHg |
|---|
| Molecular Formula | C19H23NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 255.8ºC |
|---|
Names
| Name | (8R,9S,10R,13S,14S)-4-amino-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,17-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 499.4ºC at 760mmHg |
|---|
| Molecular Formula | C19H23NO2 |
|---|
| Molecular Weight | 297.39100 |
|---|
| Flash Point | 255.8ºC |
|---|
| Exact Mass | 297.17300 |
|---|
| PSA | 60.16000 |
|---|
| LogP | 3.62610 |
|---|
| Vapour Pressure | 4.16E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | DAKHYLIFCYPHQW-KZQROQTASA-N |
|---|
| SMILES | CC12C=CC(=O)C(N)=C1C=CC1C2CCC2(C)C(=O)CCC12 |
|---|
Synonyms
| 4-aminoandrosta-1,4,6-trien-3,17-dione |
| Minamestanum [INN-Latin] |
| Minamestanum |
| 4-amino-androsta-1,4,6-triene-3,17-dione |
| Minamestane |
| Minamestano [INN-Spanish] |
| Minamestano |
