Introduction:Basic information about CAS 3057-04-3|Chenodiol methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Chenodiol methyl ester |
|---|
| CAS Number | 3057-04-3 | Molecular Weight | 406.599 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 507.6±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H42O4 | Melting Point | 61 °C |
|---|
| MSDS | / | Flash Point | 162.1±16.7 °C |
|---|
Names
| Name | methyl chenodeoxycholate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 507.6±25.0 °C at 760 mmHg |
|---|
| Melting Point | 61 °C |
|---|
| Molecular Formula | C25H42O4 |
|---|
| Molecular Weight | 406.599 |
|---|
| Flash Point | 162.1±16.7 °C |
|---|
| Exact Mass | 406.308319 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 5.12 |
|---|
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.526 |
|---|
| InChIKey | GRQROVWZGGDYSW-IFJDUOSNSA-N |
|---|
| SMILES | COC(=O)CCC(C)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C |
|---|
Synonyms
| Methyl (3α,7α)-3,7-dihydroxycholan-24-oate |
| Cholan-24-oic acid, 3,7-dihydroxy-, methyl ester, (3α,7α)- |
| Chenodiol methyl ester |
| Chenodeoxycholic acid methylester |
| Methyl (3α,5β,7α)-3,7-dihydroxycholan-24-oate |
| 5β-Cholan-24-oic acid, 3α,7α-dihydroxy-, methyl ester |
| Methyl chenodeoxycholate |
| Chenodeoxycholic acid methyl |
| Methyl (3α,5β,7α,8ξ,20R)-3,7-dihydroxycholan-24-oate |
| 3α,7α-Dihydroxy-5β-cholan-24-oic Acid Methyl ester |
| Cholan-24-oic acid, 3,7-dihydroxy-, methyl ester, (3α,5β,7α)- |
| Cholan-24-oic acid, 3,7-dihydroxy-, methyl ester, (3α,5β,7α,8ξ,20R)- |