Introduction：Basic information about CAS 883-94-3|2-Chloro-7-(trifluoromethyl)quinoxaline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-7-(trifluoromethyl)quinoxaline |
|---|
| CAS Number | 883-94-3 | Molecular Weight | 232.590 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 262.0±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H4ClF3N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 112.2±25.9 °C |
|---|
Names
| Name | 2-chloro-7-(trifluoromethyl)quinoxaline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 262.0±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H4ClF3N2 |
|---|
| Molecular Weight | 232.590 |
|---|
| Flash Point | 112.2±25.9 °C |
|---|
| Exact Mass | 232.001511 |
|---|
| PSA | 25.78000 |
|---|
| LogP | 3.17 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | QZIICAUFDSJYTM-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc2ncc(Cl)nc2c1 |
|---|
Synonyms
| 2-Chlor-7-trifluormethyl-chinoxalin |
| 2-Cl-7-CF3-Chinoxalin |
| Quinoxaline, 2-chloro-7-(trifluoromethyl)- |
| 2-Chloro-7-trifluoromethylquinoxaline |
| 2-Chloro-7-(trifluoromethyl)quinoxaline |
