Introduction：Basic information about CAS 941-70-8|Cyclohexanecarboxamide,4,4-dimethyl-2,6-dioxo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cyclohexanecarboxamide,4,4-dimethyl-2,6-dioxo- |
|---|
| CAS Number | 941-70-8 | Molecular Weight | 183.20400 |
|---|
| Density | 1.172g/cm3 | Boiling Point | 411.1ºC at 760mmHg |
|---|
| Molecular Formula | C9H13NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 202.4ºC |
|---|
Names
| Name | 4,4-Dimethyl-2,6-dioxo-cyclohexanecarboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.172g/cm3 |
|---|
| Boiling Point | 411.1ºC at 760mmHg |
|---|
| Molecular Formula | C9H13NO3 |
|---|
| Molecular Weight | 183.20400 |
|---|
| Flash Point | 202.4ºC |
|---|
| Exact Mass | 183.09000 |
|---|
| PSA | 77.23000 |
|---|
| LogP | 0.74640 |
|---|
| Index of Refraction | 1.492 |
|---|
| InChIKey | CXYHFBSJWRHKML-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)CC(=O)C(C(N)=O)C(=O)C1 |
|---|
Safety Information
Customs
| HS Code | 2924199090 |
|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-carbamoyldimedone |
| 2-carbamoyl-5,5-dimethylcyclohexane-1,3-dione |
| 2-carbamoyl-5,5-dimethyl-1,3-cyclohexanedione |
| 2-Carbamoyl-5,5-dimethyl-1,3-cyclohexandion |
| 2-Carbamoyl-5,5-dimethyl-1,4-hexanedione |
| 2-Carbamoyl-dimedon |
| 4,4-dimethyl-2,6-dioxo-cyclohexane-1-carboxamide |
| 4.4-Dimethyl-cyclohexadion-(2.6)-carbonsaeureamid |
| 5,5-Dimethyl-2-carbamoyl-cyclohexan-1,3-dion |
| 2,6-diketo-4,4-dimethyl-cyclohexanecarboxamide |
