Introduction:Basic information about CAS 50424-93-6|3-methyl-2-nitrobenzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-methyl-2-nitrobenzoyl chloride |
|---|
| CAS Number | 50424-93-6 | Molecular Weight | 199.59100 |
|---|
| Density | 1.386g/cm3 | Boiling Point | 310.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 141.5ºC |
|---|
Names
| Name | 3-methyl-2-nitrobenzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.386g/cm3 |
|---|
| Boiling Point | 310.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6ClNO3 |
|---|
| Molecular Weight | 199.59100 |
|---|
| Flash Point | 141.5ºC |
|---|
| Exact Mass | 199.00400 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 2.80540 |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | YVHZCFAUJFDIJY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc(C(=O)Cl)c1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-methyl-6-chlorocarbonyl-nitrobenzene |
| 3-methyl-2-nitro-benzoyl chloride |
| 3-Methyl-2-nitro-benzoylchlorid |