Introduction：Basic information about CAS 892502-14-6|2-Morpholino-5-(trifluoromethyl)benzylamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Morpholino-5-(trifluoromethyl)benzylamine |
|---|
| CAS Number | 892502-14-6 | Molecular Weight | 260.25600 |
|---|
| Density | 1.261g/cm3 | Boiling Point | 352.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15F3N2O | Melting Point | 31ºC |
|---|
| MSDS | / | Flash Point | 167ºC |
|---|
Names
| Name | [2-morpholin-4-yl-5-(trifluoromethyl)phenyl]methanamine |
|---|
Chemical & Physical Properties
| Density | 1.261g/cm3 |
|---|
| Boiling Point | 352.5ºC at 760 mmHg |
|---|
| Melting Point | 31ºC |
|---|
| Molecular Formula | C12H15F3N2O |
|---|
| Molecular Weight | 260.25600 |
|---|
| Flash Point | 167ºC |
|---|
| Exact Mass | 260.11400 |
|---|
| PSA | 38.49000 |
|---|
| LogP | 2.76600 |
|---|
| Index of Refraction | 1.508 |
|---|
| InChIKey | IENPBNBXMPGBEX-UHFFFAOYSA-N |
|---|
| SMILES | NCc1cc(C(F)(F)F)ccc1N1CCOCC1 |
|---|
